C17H28N2O7S2 — CID 23399598
2-(2-hydroxyethylsulfonylmethylsulfonyl)ethyl N-[4-(diethylamino)-2-methylphenyl]carbamate (PubChem CID 23399598) has the molecular formula C17H28N2O7S2 and a molecular weight of 436.55 g/mol. Its IUPAC name is 2-(2-hydroxyethylsulfonylmethylsulfonyl)ethyl N-[4-(diethylamino)-2-methylphenyl]carbamate.
| Compound Name | 2-(2-hydroxyethylsulfonylmethylsulfonyl)ethyl N-[4-(diethylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 23399598 |
| Molecular Formula | C17H28N2O7S2 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-(2-hydroxyethylsulfonylmethylsulfonyl)ethyl N-[4-(diethylamino)-2-methylphenyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)OCCS(=O)(=O)CS(=O)(=O)CCO)c(C)c1 |
| InChI | InChI=1S/C17H28N2O7S2/c1-4-19(5-2)15-6-7-16(14(3)12-15)18-17(21)26-9-11-28(24,25)13-27(22,23)10-8-20/h6-7,12,20H,4-5,8-11,13H2,1-3H3,(H,18,21) |
| InChIKey | DLAAVPRCYNUWGQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|