C21H27ClN2O4S — CID 22955870
[2-(chloromethylsulfonyl)-1-phenylethyl] N-[4-(diethylamino)-2-methylphenyl]carbamate (PubChem CID 22955870) has the molecular formula C21H27ClN2O4S and a molecular weight of 438.98 g/mol. Its IUPAC name is [2-(chloromethylsulfonyl)-1-phenylethyl] N-[4-(diethylamino)-2-methylphenyl]carbamate.
| Compound Name | [2-(chloromethylsulfonyl)-1-phenylethyl] N-[4-(diethylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 22955870 |
| Molecular Formula | C21H27ClN2O4S |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | [2-(chloromethylsulfonyl)-1-phenylethyl] N-[4-(diethylamino)-2-methylphenyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)OC(CS(=O)(=O)CCl)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H27ClN2O4S/c1-4-24(5-2)18-11-12-19(16(3)13-18)23-21(25)28-20(14-29(26,27)15-22)17-9-7-6-8-10-17/h6-13,20H,4-5,14-15H2,1-3H3,(H,23,25) |
| InChIKey | YXLBCYUKIBWNGL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|