C16H22ClF3N2O3S2 — CID 142101897
S-[3-(chloromethylsulfonyl)-1,1,1-trifluoropropan-2-yl] N-[4-(diethylamino)-2-methylphenyl]carbamothioate (PubChem CID 142101897) has the molecular formula C16H22ClF3N2O3S2 and a molecular weight of 446.94 g/mol. Its IUPAC name is S-[3-(chloromethylsulfonyl)-1,1,1-trifluoropropan-2-yl] N-[4-(diethylamino)-2-methylphenyl]carbamothioate.
| Compound Name | S-[3-(chloromethylsulfonyl)-1,1,1-trifluoropropan-2-yl] N-[4-(diethylamino)-2-methylphenyl]carbamothioate |
|---|---|
| PubChem CID | 142101897 |
| Molecular Formula | C16H22ClF3N2O3S2 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | S-[3-(chloromethylsulfonyl)-1,1,1-trifluoropropan-2-yl] N-[4-(diethylamino)-2-methylphenyl]carbamothioate |
| SMILES | CCN(CC)c1ccc(NC(=O)SC(CS(=O)(=O)CCl)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C16H22ClF3N2O3S2/c1-4-22(5-2)12-6-7-13(11(3)8-12)21-15(23)26-14(16(18,19)20)9-27(24,25)10-17/h6-8,14H,4-5,9-10H2,1-3H3,(H,21,23) |
| InChIKey | JITFPFXUPMIUAB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|