C21H27Cl2N3O3S — CID 142102028
1-[2-(chloromethylsulfonyl)-1-(4-chlorophenyl)ethyl]-3-[4-(diethylamino)-2-methylphenyl]urea (PubChem CID 142102028) has the molecular formula C21H27Cl2N3O3S and a molecular weight of 472.44 g/mol. Its IUPAC name is 1-[2-(chloromethylsulfonyl)-1-(4-chlorophenyl)ethyl]-3-[4-(diethylamino)-2-methylphenyl]urea.
| Compound Name | 1-[2-(chloromethylsulfonyl)-1-(4-chlorophenyl)ethyl]-3-[4-(diethylamino)-2-methylphenyl]urea |
|---|---|
| PubChem CID | 142102028 |
| Molecular Formula | C21H27Cl2N3O3S |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 1-[2-(chloromethylsulfonyl)-1-(4-chlorophenyl)ethyl]-3-[4-(diethylamino)-2-methylphenyl]urea |
| SMILES | CCN(CC)c1ccc(NC(=O)NC(CS(=O)(=O)CCl)c2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C21H27Cl2N3O3S/c1-4-26(5-2)18-10-11-19(15(3)12-18)24-21(27)25-20(13-30(28,29)14-22)16-6-8-17(23)9-7-16/h6-12,20H,4-5,13-14H2,1-3H3,(H2,24,25,27) |
| InChIKey | MOHCZPLZFBITNO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|