C16H20BrClN3O2- — CID 108873063
1-(5-bromofuran-2-yl)-3-[4-(diethylamino)-2-methylphenyl]urea chloride (PubChem CID 108873063) has the molecular formula C16H20BrClN3O2- and a molecular weight of 401.71 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-3-[4-(diethylamino)-2-methylphenyl]urea chloride.
| Compound Name | 1-(5-bromofuran-2-yl)-3-[4-(diethylamino)-2-methylphenyl]urea chloride |
|---|---|
| PubChem CID | 108873063 |
| Molecular Formula | C16H20BrClN3O2- |
| Molecular Weight | 401.71 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-3-[4-(diethylamino)-2-methylphenyl]urea chloride |
| SMILES | CCN(CC)c1ccc(NC(=O)Nc2ccc(Br)o2)c(C)c1.[Cl-] |
| InChI | InChI=1S/C16H20BrN3O2.ClH/c1-4-20(5-2)12-6-7-13(11(3)10-12)18-16(21)19-15-9-8-14(17)22-15;/h6-10H,4-5H2,1-3H3,(H2,18,19,21);1H/p-1 |
| InChIKey | WBCVHRIMANTOLW-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.71 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|