C13H13BrN2O2 — CID 108872887
1-(5-bromofuran-2-yl)-3-(2,4-dimethylphenyl)urea (PubChem CID 108872887) has the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-3-(2,4-dimethylphenyl)urea.
| Compound Name | 1-(5-bromofuran-2-yl)-3-(2,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 108872887 |
| Molecular Formula | C13H13BrN2O2 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-3-(2,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(Br)o2)c(C)c1 |
| InChI | InChI=1S/C13H13BrN2O2/c1-8-3-4-10(9(2)7-8)15-13(17)16-12-6-5-11(14)18-12/h3-7H,1-2H3,(H2,15,16,17) |
| InChIKey | NXQAXLLBMMZJMI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |