C12H13Br2NO2 — CID 102494269
2,4-dibromo-N-(2,4-dimethylphenyl)-3-oxobutanamide (PubChem CID 102494269) has the molecular formula C12H13Br2NO2 and a molecular weight of 363.05 g/mol. Its IUPAC name is 2,4-dibromo-N-(2,4-dimethylphenyl)-3-oxobutanamide.
| Compound Name | 2,4-dibromo-N-(2,4-dimethylphenyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 102494269 |
| Molecular Formula | C12H13Br2NO2 |
| Molecular Weight | 363.05 g/mol |
| Exact Mass | 360.93 |
| IUPAC Name | 2,4-dibromo-N-(2,4-dimethylphenyl)-3-oxobutanamide |
| SMILES | Cc1ccc(NC(=O)C(Br)C(=O)CBr)c(C)c1 |
| InChI | InChI=1S/C12H13Br2NO2/c1-7-3-4-9(8(2)5-7)15-12(17)11(14)10(16)6-13/h3-5,11H,6H2,1-2H3,(H,15,17) |
| InChIKey | JCWARJULWLADAK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.05 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|