C9H10FNO — CID 88833294
N-(2,4-dimethylphenyl)carbamoyl fluoride (PubChem CID 88833294) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)carbamoyl fluoride.
| Compound Name | N-(2,4-dimethylphenyl)carbamoyl fluoride |
|---|---|
| PubChem CID | 88833294 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | N-(2,4-dimethylphenyl)carbamoyl fluoride |
| SMILES | Cc1ccc(NC(=O)F)c(C)c1 |
| InChI | InChI=1S/C9H10FNO/c1-6-3-4-8(7(2)5-6)11-9(10)12/h3-5H,1-2H3,(H,11,12) |
| InChIKey | NDXSJQOFSXDTQE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|