C11H17ClN2O — CID 50944164
3-amino-N-(2,4-dimethylphenyl)propanamide;hydrochloride (PubChem CID 50944164) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 3-amino-N-(2,4-dimethylphenyl)propanamide;hydrochloride.
| Compound Name | 3-amino-N-(2,4-dimethylphenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 50944164 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-amino-N-(2,4-dimethylphenyl)propanamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)CCN)c(C)c1.Cl |
| InChI | InChI=1S/C11H16N2O.ClH/c1-8-3-4-10(9(2)7-8)13-11(14)5-6-12;/h3-4,7H,5-6,12H2,1-2H3,(H,13,14);1H |
| InChIKey | NCPRNNMKIXEMQW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |