C16H23N3O3 — CID 5199281
4-(2-butanoylhydrazinyl)-N-(2,4-dimethylphenyl)-4-oxobutanamide (PubChem CID 5199281) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 4-(2-butanoylhydrazinyl)-N-(2,4-dimethylphenyl)-4-oxobutanamide.
| Compound Name | 4-(2-butanoylhydrazinyl)-N-(2,4-dimethylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 5199281 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 4-(2-butanoylhydrazinyl)-N-(2,4-dimethylphenyl)-4-oxobutanamide |
| SMILES | CCCC(=O)NNC(=O)CCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C16H23N3O3/c1-4-5-15(21)18-19-16(22)9-8-14(20)17-13-7-6-11(2)10-12(13)3/h6-7,10H,4-5,8-9H2,1-3H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | OUDUBXKTRQHARQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|