C19H23IN2O2 — CID 90975910
N-(2,4-dimethylphenyl)acetamide;N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 90975910) has the molecular formula C19H23IN2O2 and a molecular weight of 438.31 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)acetamide;N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | N-(2,4-dimethylphenyl)acetamide;N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 90975910 |
| Molecular Formula | C19H23IN2O2 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | N-(2,4-dimethylphenyl)acetamide;N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | CC(=O)Nc1ccc(C)cc1C.CC(=O)Nc1ccc(I)cc1C |
| InChI | InChI=1S/C10H13NO.C9H10INO/c1-7-4-5-10(8(2)6-7)11-9(3)12;1-6-5-8(10)3-4-9(6)11-7(2)12/h4-6H,1-3H3,(H,11,12);3-5H,1-2H3,(H,11,12) |
| InChIKey | OLFMQLQNZWVFIP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|