C13H16IN3O3 — CID 47226232
N-(2-acetamidoethyl)-N'-(4-iodo-2-methylphenyl)oxamide (PubChem CID 47226232) has the molecular formula C13H16IN3O3 and a molecular weight of 389.19 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-N'-(4-iodo-2-methylphenyl)oxamide.
| Compound Name | N-(2-acetamidoethyl)-N'-(4-iodo-2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 47226232 |
| Molecular Formula | C13H16IN3O3 |
| Molecular Weight | 389.19 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | N-(2-acetamidoethyl)-N'-(4-iodo-2-methylphenyl)oxamide |
| SMILES | CC(=O)NCCNC(=O)C(=O)Nc1ccc(I)cc1C |
| InChI | InChI=1S/C13H16IN3O3/c1-8-7-10(14)3-4-11(8)17-13(20)12(19)16-6-5-15-9(2)18/h3-4,7H,5-6H2,1-2H3,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | YNVQIERPBKVFMN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|