C12H15IN2O3 — CID 47225790
N-(2-hydroxypropyl)-N'-(4-iodo-2-methylphenyl)oxamide (PubChem CID 47225790) has the molecular formula C12H15IN2O3 and a molecular weight of 362.17 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-N'-(4-iodo-2-methylphenyl)oxamide.
| Compound Name | N-(2-hydroxypropyl)-N'-(4-iodo-2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 47225790 |
| Molecular Formula | C12H15IN2O3 |
| Molecular Weight | 362.17 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | N-(2-hydroxypropyl)-N'-(4-iodo-2-methylphenyl)oxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C(=O)NCC(C)O |
| InChI | InChI=1S/C12H15IN2O3/c1-7-5-9(13)3-4-10(7)15-12(18)11(17)14-6-8(2)16/h3-5,8,16H,6H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | WCKQAJOUKBAISH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|