C12H17N3O3 — CID 108521402
N'-(2-amino-4-methylphenyl)-N-(2-hydroxypropyl)oxamide (PubChem CID 108521402) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is N'-(2-amino-4-methylphenyl)-N-(2-hydroxypropyl)oxamide.
| Compound Name | N'-(2-amino-4-methylphenyl)-N-(2-hydroxypropyl)oxamide |
|---|---|
| PubChem CID | 108521402 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N'-(2-amino-4-methylphenyl)-N-(2-hydroxypropyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCC(C)O)c(N)c1 |
| InChI | InChI=1S/C12H17N3O3/c1-7-3-4-10(9(13)5-7)15-12(18)11(17)14-6-8(2)16/h3-5,8,16H,6,13H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | JZZFMRZVIFYLGO-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|