C17H25IN2O2 — CID 108516418
N-(4-iodo-2-methylphenyl)-N',N'-bis(2-methylpropyl)oxamide (PubChem CID 108516418) has the molecular formula C17H25IN2O2 and a molecular weight of 416.30 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-N',N'-bis(2-methylpropyl)oxamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-N',N'-bis(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 108516418 |
| Molecular Formula | C17H25IN2O2 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-N',N'-bis(2-methylpropyl)oxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C17H25IN2O2/c1-11(2)9-20(10-12(3)4)17(22)16(21)19-15-7-6-14(18)8-13(15)5/h6-8,11-12H,9-10H2,1-5H3,(H,19,21) |
| InChIKey | APETXMGUKIWUKD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|