C11H13IN2O3 — CID 108516391
N-(2-hydroxyethyl)-N'-(4-iodo-2-methylphenyl)oxamide (PubChem CID 108516391) has the molecular formula C11H13IN2O3 and a molecular weight of 348.14 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N'-(4-iodo-2-methylphenyl)oxamide.
| Compound Name | N-(2-hydroxyethyl)-N'-(4-iodo-2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108516391 |
| Molecular Formula | C11H13IN2O3 |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | N-(2-hydroxyethyl)-N'-(4-iodo-2-methylphenyl)oxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C(=O)NCCO |
| InChI | InChI=1S/C11H13IN2O3/c1-7-6-8(12)2-3-9(7)14-11(17)10(16)13-4-5-15/h2-3,6,15H,4-5H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | KREGMPHDXKTYRZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|