C13H13BrN2O4 — CID 108872949
1-(5-bromofuran-2-yl)-3-(2,4-dimethoxyphenyl)urea (PubChem CID 108872949) has the molecular formula C13H13BrN2O4 and a molecular weight of 341.16 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-3-(2,4-dimethoxyphenyl)urea.
| Compound Name | 1-(5-bromofuran-2-yl)-3-(2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 108872949 |
| Molecular Formula | C13H13BrN2O4 |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-3-(2,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(Br)o2)c(OC)c1 |
| InChI | InChI=1S/C13H13BrN2O4/c1-18-8-3-4-9(10(7-8)19-2)15-13(17)16-12-6-5-11(14)20-12/h3-7H,1-2H3,(H2,15,16,17) |
| InChIKey | BJPXESUAHURQDQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |