C13H20N2O4 — CID 94812273
1-(2,4-dimethoxyphenyl)-3-[(2S)-1-methoxypropan-2-yl]urea (PubChem CID 94812273) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[(2S)-1-methoxypropan-2-yl]urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[(2S)-1-methoxypropan-2-yl]urea |
|---|---|
| PubChem CID | 94812273 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[(2S)-1-methoxypropan-2-yl]urea |
| SMILES | COC[C@H](C)NC(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C13H20N2O4/c1-9(8-17-2)14-13(16)15-11-6-5-10(18-3)7-12(11)19-4/h5-7,9H,8H2,1-4H3,(H2,14,15,16)/t9-/m0/s1 |
| InChIKey | XYFCVWALAVEGRV-VIFPVBQESA-N |
| XLogP | 1.86 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |