C14H20N2O5 — CID 79009289
(2R)-2-[(2,4-dimethoxyphenyl)carbamoylamino]-3-methylbutanoic acid (PubChem CID 79009289) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is (2R)-2-[(2,4-dimethoxyphenyl)carbamoylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(2,4-dimethoxyphenyl)carbamoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 79009289 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (2R)-2-[(2,4-dimethoxyphenyl)carbamoylamino]-3-methylbutanoic acid |
| SMILES | COc1ccc(NC(=O)N[C@@H](C(=O)O)C(C)C)c(OC)c1 |
| InChI | InChI=1S/C14H20N2O5/c1-8(2)12(13(17)18)16-14(19)15-10-6-5-9(20-3)7-11(10)21-4/h5-8,12H,1-4H3,(H,17,18)(H2,15,16,19)/t12-/m1/s1 |
| InChIKey | LIDHVLUXWFUNFT-GFCCVEGCSA-N |
| XLogP | 1.93 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |