C19H23Cl3N4O4S — CID 22964730
(1,1,1-trichloro-3-pyrimidin-4-ylsulfonylpropan-2-yl) N-[4-(diethylamino)-2-methylphenyl]carbamate (PubChem CID 22964730) has the molecular formula C19H23Cl3N4O4S and a molecular weight of 509.84 g/mol. Its IUPAC name is (1,1,1-trichloro-3-pyrimidin-4-ylsulfonylpropan-2-yl) N-[4-(diethylamino)-2-methylphenyl]carbamate.
| Compound Name | (1,1,1-trichloro-3-pyrimidin-4-ylsulfonylpropan-2-yl) N-[4-(diethylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 22964730 |
| Molecular Formula | C19H23Cl3N4O4S |
| Molecular Weight | 509.84 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | (1,1,1-trichloro-3-pyrimidin-4-ylsulfonylpropan-2-yl) N-[4-(diethylamino)-2-methylphenyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)OC(CS(=O)(=O)c2ccncn2)C(Cl)(Cl)Cl)c(C)c1 |
| InChI | InChI=1S/C19H23Cl3N4O4S/c1-4-26(5-2)14-6-7-15(13(3)10-14)25-18(27)30-16(19(20,21)22)11-31(28,29)17-8-9-23-12-24-17/h6-10,12,16H,4-5,11H2,1-3H3,(H,25,27) |
| InChIKey | HULPKZOGBRBXMC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.84 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|