C21H28N2O3 — CID 22889588
1-(4-methoxyphenyl)ethyl N-[4-(diethylamino)-2-methylphenyl]carbamate (PubChem CID 22889588) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)ethyl N-[4-(diethylamino)-2-methylphenyl]carbamate.
| Compound Name | 1-(4-methoxyphenyl)ethyl N-[4-(diethylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 22889588 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1-(4-methoxyphenyl)ethyl N-[4-(diethylamino)-2-methylphenyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)OC(C)c2ccc(OC)cc2)c(C)c1 |
| InChI | InChI=1S/C21H28N2O3/c1-6-23(7-2)18-10-13-20(15(3)14-18)22-21(24)26-16(4)17-8-11-19(25-5)12-9-17/h8-14,16H,6-7H2,1-5H3,(H,22,24) |
| InChIKey | OCXSWGIYXWSVCZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|