C23H29N3O3 — CID 109143459
1-N-[4-(diethylamino)-2-methylphenyl]-2-N-(4-methoxyphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109143459) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-N-[4-(diethylamino)-2-methylphenyl]-2-N-(4-methoxyphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-[4-(diethylamino)-2-methylphenyl]-2-N-(4-methoxyphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109143459 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1-N-[4-(diethylamino)-2-methylphenyl]-2-N-(4-methoxyphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2CC2C(=O)Nc2ccc(OC)cc2)c(C)c1 |
| InChI | InChI=1S/C23H29N3O3/c1-5-26(6-2)17-9-12-21(15(3)13-17)25-23(28)20-14-19(20)22(27)24-16-7-10-18(29-4)11-8-16/h7-13,19-20H,5-6,14H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | NIVJXANEOWTISB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|