C20H26N4O3 — CID 109144211
2-N-[4-(diethylamino)-2-methylphenyl]-1-N-(5-methyl-1,2-oxazol-3-yl)cyclopropane-1,2-dicarboxamide (PubChem CID 109144211) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-N-[4-(diethylamino)-2-methylphenyl]-1-N-(5-methyl-1,2-oxazol-3-yl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-[4-(diethylamino)-2-methylphenyl]-1-N-(5-methyl-1,2-oxazol-3-yl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109144211 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-N-[4-(diethylamino)-2-methylphenyl]-1-N-(5-methyl-1,2-oxazol-3-yl)cyclopropane-1,2-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2CC2C(=O)Nc2cc(C)on2)c(C)c1 |
| InChI | InChI=1S/C20H26N4O3/c1-5-24(6-2)14-7-8-17(12(3)9-14)21-19(25)15-11-16(15)20(26)22-18-10-13(4)27-23-18/h7-10,15-16H,5-6,11H2,1-4H3,(H,21,25)(H,22,23,26) |
| InChIKey | APRXLHIORCBNRF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|