C16H22N4O2 — CID 109010414
2-[4-(diethylamino)anilino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 109010414) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-[4-(diethylamino)anilino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[4-(diethylamino)anilino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 109010414 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-[4-(diethylamino)anilino]-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | CCN(CC)c1ccc(NCC(=O)Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C16H22N4O2/c1-4-20(5-2)14-8-6-13(7-9-14)17-11-16(21)18-15-10-12(3)22-19-15/h6-10,17H,4-5,11H2,1-3H3,(H,18,19,21) |
| InChIKey | IQJXDVJOGWNKTJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|