C21H25N5O2 — CID 109200907
5-[4-(diethylamino)-2-methylanilino]-N-(5-methyl-1,2-oxazol-3-yl)pyridine-2-carboxamide (PubChem CID 109200907) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 5-[4-(diethylamino)-2-methylanilino]-N-(5-methyl-1,2-oxazol-3-yl)pyridine-2-carboxamide.
| Compound Name | 5-[4-(diethylamino)-2-methylanilino]-N-(5-methyl-1,2-oxazol-3-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109200907 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 5-[4-(diethylamino)-2-methylanilino]-N-(5-methyl-1,2-oxazol-3-yl)pyridine-2-carboxamide |
| SMILES | CCN(CC)c1ccc(Nc2ccc(C(=O)Nc3cc(C)on3)nc2)c(C)c1 |
| InChI | InChI=1S/C21H25N5O2/c1-5-26(6-2)17-8-10-18(14(3)11-17)23-16-7-9-19(22-13-16)21(27)24-20-12-15(4)28-25-20/h7-13,23H,5-6H2,1-4H3,(H,24,25,27) |
| InChIKey | WOAQUULUDAWMDQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|