C20H29N5O — CID 113036973
1-[5-[4-(diethylamino)-2-methylanilino]-2-pyridinyl]-3-propan-2-ylurea (PubChem CID 113036973) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 1-[5-[4-(diethylamino)-2-methylanilino]-2-pyridinyl]-3-propan-2-ylurea.
| Compound Name | 1-[5-[4-(diethylamino)-2-methylanilino]-2-pyridinyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 113036973 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 1-[5-[4-(diethylamino)-2-methylanilino]-2-pyridinyl]-3-propan-2-ylurea |
| SMILES | CCN(CC)c1ccc(Nc2ccc(NC(=O)NC(C)C)nc2)c(C)c1 |
| InChI | InChI=1S/C20H29N5O/c1-6-25(7-2)17-9-10-18(15(5)12-17)23-16-8-11-19(21-13-16)24-20(26)22-14(3)4/h8-14,23H,6-7H2,1-5H3,(H2,21,22,24,26) |
| InChIKey | LLEHXKAKEHTMTF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|