C21H24N4OS — CID 113022556
N-[6-[4-(diethylamino)-2-methylanilino]-3-pyridinyl]thiophene-2-carboxamide (PubChem CID 113022556) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is N-[6-[4-(diethylamino)-2-methylanilino]-3-pyridinyl]thiophene-2-carboxamide.
| Compound Name | N-[6-[4-(diethylamino)-2-methylanilino]-3-pyridinyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 113022556 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[6-[4-(diethylamino)-2-methylanilino]-3-pyridinyl]thiophene-2-carboxamide |
| SMILES | CCN(CC)c1ccc(Nc2ccc(NC(=O)c3cccs3)cn2)c(C)c1 |
| InChI | InChI=1S/C21H24N4OS/c1-4-25(5-2)17-9-10-18(15(3)13-17)24-20-11-8-16(14-22-20)23-21(26)19-7-6-12-27-19/h6-14H,4-5H2,1-3H3,(H,22,24)(H,23,26) |
| InChIKey | HUHMNAHRDREIBO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|