C22H29N3O4 — CID 108955947
N-[4-(diethylamino)-2-methylphenyl]-N'-(2,5-dimethoxyphenyl)propanediamide (PubChem CID 108955947) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-N'-(2,5-dimethoxyphenyl)propanediamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-N'-(2,5-dimethoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 108955947 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-N'-(2,5-dimethoxyphenyl)propanediamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CC(=O)Nc2cc(OC)ccc2OC)c(C)c1 |
| InChI | InChI=1S/C22H29N3O4/c1-6-25(7-2)16-8-10-18(15(3)12-16)23-21(26)14-22(27)24-19-13-17(28-4)9-11-20(19)29-5/h8-13H,6-7,14H2,1-5H3,(H,23,26)(H,24,27) |
| InChIKey | FUXPPNRLBIMAMQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|