C21H25N3O2 — CID 22948519
(2-cyano-1-phenylethyl) N-[4-(diethylamino)-2-methylphenyl]carbamate (PubChem CID 22948519) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2-cyano-1-phenylethyl) N-[4-(diethylamino)-2-methylphenyl]carbamate.
| Compound Name | (2-cyano-1-phenylethyl) N-[4-(diethylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 22948519 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (2-cyano-1-phenylethyl) N-[4-(diethylamino)-2-methylphenyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)OC(CC#N)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H25N3O2/c1-4-24(5-2)18-11-12-19(16(3)15-18)23-21(25)26-20(13-14-22)17-9-7-6-8-10-17/h6-12,15,20H,4-5,13H2,1-3H3,(H,23,25) |
| InChIKey | FXUYZYNQKUFPQR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|