C27H34N2O4 — CID 142101970
formaldehyde;[1-(furan-2-yl)-3-(4-methylphenyl)propyl] N-[4-(diethylamino)-2-methylphenyl]carbamate (PubChem CID 142101970) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is formaldehyde;[1-(furan-2-yl)-3-(4-methylphenyl)propyl] N-[4-(diethylamino)-2-methylphenyl]carbamate.
| Compound Name | formaldehyde;[1-(furan-2-yl)-3-(4-methylphenyl)propyl] N-[4-(diethylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 142101970 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | formaldehyde;[1-(furan-2-yl)-3-(4-methylphenyl)propyl] N-[4-(diethylamino)-2-methylphenyl]carbamate |
| SMILES | C=O.CCN(CC)c1ccc(NC(=O)OC(CCc2ccc(C)cc2)c2ccco2)c(C)c1 |
| InChI | InChI=1S/C26H32N2O3.CH2O/c1-5-28(6-2)22-14-15-23(20(4)18-22)27-26(29)31-25(24-8-7-17-30-24)16-13-21-11-9-19(3)10-12-21;1-2/h7-12,14-15,17-18,25H,5-6,13,16H2,1-4H3,(H,27,29);1H2 |
| InChIKey | DYSMRLGAADMMFD-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|