C24H34N2O2 — CID 23514727
1-(4-butan-2-ylphenyl)ethyl N-[4-(diethylamino)-2-methylphenyl]carbamate (PubChem CID 23514727) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)ethyl N-[4-(diethylamino)-2-methylphenyl]carbamate.
| Compound Name | 1-(4-butan-2-ylphenyl)ethyl N-[4-(diethylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 23514727 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)ethyl N-[4-(diethylamino)-2-methylphenyl]carbamate |
| SMILES | CCC(C)c1ccc(C(C)OC(=O)Nc2ccc(N(CC)CC)cc2C)cc1 |
| InChI | InChI=1S/C24H34N2O2/c1-7-17(4)20-10-12-21(13-11-20)19(6)28-24(27)25-23-15-14-22(16-18(23)5)26(8-2)9-3/h10-17,19H,7-9H2,1-6H3,(H,25,27) |
| InChIKey | HJZNUPNGNARPQG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|