C18H29N3O2 — CID 113001640
N-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]-3-methylbutanamide (PubChem CID 113001640) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is N-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]-3-methylbutanamide.
| Compound Name | N-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 113001640 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | N-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]-3-methylbutanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CNC(=O)CC(C)C)c(C)c1 |
| InChI | InChI=1S/C18H29N3O2/c1-6-21(7-2)15-8-9-16(14(5)11-15)20-18(23)12-19-17(22)10-13(3)4/h8-9,11,13H,6-7,10,12H2,1-5H3,(H,19,22)(H,20,23) |
| InChIKey | STYSNSBHYQWTKD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|