C18H29N3O3 — CID 113001690
tert-butyl N-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]carbamate (PubChem CID 113001690) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 113001690 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | tert-butyl N-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)CNC(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C18H29N3O3/c1-7-21(8-2)14-9-10-15(13(3)11-14)20-16(22)12-19-17(23)24-18(4,5)6/h9-11H,7-8,12H2,1-6H3,(H,19,23)(H,20,22) |
| InChIKey | YCIICPBKKNYINM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|