C20H33N3O3S — CID 84553604
tert-butyl N-[2-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]sulfanylethyl]carbamate (PubChem CID 84553604) has the molecular formula C20H33N3O3S and a molecular weight of 395.57 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 84553604 |
| Molecular Formula | C20H33N3O3S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | tert-butyl N-[2-[2-[4-(diethylamino)-2-methylanilino]-2-oxoethyl]sulfanylethyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)CSCCNC(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C20H33N3O3S/c1-7-23(8-2)16-9-10-17(15(3)13-16)22-18(24)14-27-12-11-21-19(25)26-20(4,5)6/h9-10,13H,7-8,11-12,14H2,1-6H3,(H,21,25)(H,22,24) |
| InChIKey | ONVFIMUWBJKQKT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|