C15H20Cl2N2O3S — CID 84553641
tert-butyl N-[2-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanylethyl]carbamate (PubChem CID 84553641) has the molecular formula C15H20Cl2N2O3S and a molecular weight of 379.31 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 84553641 |
| Molecular Formula | C15H20Cl2N2O3S |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | tert-butyl N-[2-[2-(2,3-dichloroanilino)-2-oxoethyl]sulfanylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSCC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H20Cl2N2O3S/c1-15(2,3)22-14(21)18-7-8-23-9-12(20)19-11-6-4-5-10(16)13(11)17/h4-6H,7-9H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | ZXQVPUSZBDTGOZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|