C17H26N2O6S2 — CID 84553647
tert-butyl N-[2-[2-(5-ethylsulfonyl-2-hydroxyanilino)-2-oxoethyl]sulfanylethyl]carbamate (PubChem CID 84553647) has the molecular formula C17H26N2O6S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(5-ethylsulfonyl-2-hydroxyanilino)-2-oxoethyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(5-ethylsulfonyl-2-hydroxyanilino)-2-oxoethyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 84553647 |
| Molecular Formula | C17H26N2O6S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | tert-butyl N-[2-[2-(5-ethylsulfonyl-2-hydroxyanilino)-2-oxoethyl]sulfanylethyl]carbamate |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)CSCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H26N2O6S2/c1-5-27(23,24)12-6-7-14(20)13(10-12)19-15(21)11-26-9-8-18-16(22)25-17(2,3)4/h6-7,10,20H,5,8-9,11H2,1-4H3,(H,18,22)(H,19,21) |
| InChIKey | JNSMORNKYCLEKI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|