C10H13NO5S — CID 71211128
methyl N-(5-ethylsulfonyl-2-hydroxyphenyl)carbamate (PubChem CID 71211128) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is methyl N-(5-ethylsulfonyl-2-hydroxyphenyl)carbamate.
| Compound Name | methyl N-(5-ethylsulfonyl-2-hydroxyphenyl)carbamate |
|---|---|
| PubChem CID | 71211128 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | methyl N-(5-ethylsulfonyl-2-hydroxyphenyl)carbamate |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)OC)c1 |
| InChI | InChI=1S/C10H13NO5S/c1-3-17(14,15)7-4-5-9(12)8(6-7)11-10(13)16-2/h4-6,12H,3H2,1-2H3,(H,11,13) |
| InChIKey | UDQSASQTCSDPAN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|