C16H15Cl2NO5S — CID 35978682
3,5-dichloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-4-methoxybenzamide (PubChem CID 35978682) has the molecular formula C16H15Cl2NO5S and a molecular weight of 404.27 g/mol. Its IUPAC name is 3,5-dichloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-4-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 35978682 |
| Molecular Formula | C16H15Cl2NO5S |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 3,5-dichloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-4-methoxybenzamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2cc(Cl)c(OC)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H15Cl2NO5S/c1-3-25(22,23)10-4-5-14(20)13(8-10)19-16(21)9-6-11(17)15(24-2)12(18)7-9/h4-8,20H,3H2,1-2H3,(H,19,21) |
| InChIKey | IUMOKGOAPYOPNC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|