C16H14Cl2N2O6S — CID 11750845
N'-(3,5-dichloro-2-hydroxyphenyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)oxamide (PubChem CID 11750845) has the molecular formula C16H14Cl2N2O6S and a molecular weight of 433.27 g/mol. Its IUPAC name is N'-(3,5-dichloro-2-hydroxyphenyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)oxamide.
| Compound Name | N'-(3,5-dichloro-2-hydroxyphenyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)oxamide |
|---|---|
| PubChem CID | 11750845 |
| Molecular Formula | C16H14Cl2N2O6S |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | N'-(3,5-dichloro-2-hydroxyphenyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)oxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)C(=O)Nc2cc(Cl)cc(Cl)c2O)c1 |
| InChI | InChI=1S/C16H14Cl2N2O6S/c1-2-27(25,26)9-3-4-13(21)11(7-9)19-15(23)16(24)20-12-6-8(17)5-10(18)14(12)22/h3-7,21-22H,2H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | BTTSFFLCLGVKSR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|