C15H12Cl2N2O4 — CID 11416940
N-(3,5-dichloro-2-hydroxyphenyl)-N'-(2-hydroxy-6-methylphenyl)oxamide (PubChem CID 11416940) has the molecular formula C15H12Cl2N2O4 and a molecular weight of 355.18 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxyphenyl)-N'-(2-hydroxy-6-methylphenyl)oxamide.
| Compound Name | N-(3,5-dichloro-2-hydroxyphenyl)-N'-(2-hydroxy-6-methylphenyl)oxamide |
|---|---|
| PubChem CID | 11416940 |
| Molecular Formula | C15H12Cl2N2O4 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxyphenyl)-N'-(2-hydroxy-6-methylphenyl)oxamide |
| SMILES | Cc1cccc(O)c1NC(=O)C(=O)Nc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H12Cl2N2O4/c1-7-3-2-4-11(20)12(7)19-15(23)14(22)18-10-6-8(16)5-9(17)13(10)21/h2-6,20-21H,1H3,(H,18,22)(H,19,23) |
| InChIKey | ODZOGCWPMWFUDO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|