C15H10Cl4N2O4 — CID 11293160
N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-N'-(3,5-dichloro-2-hydroxyphenyl)oxamide (PubChem CID 11293160) has the molecular formula C15H10Cl4N2O4 and a molecular weight of 424.07 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-N'-(3,5-dichloro-2-hydroxyphenyl)oxamide.
| Compound Name | N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-N'-(3,5-dichloro-2-hydroxyphenyl)oxamide |
|---|---|
| PubChem CID | 11293160 |
| Molecular Formula | C15H10Cl4N2O4 |
| Molecular Weight | 424.07 g/mol |
| Exact Mass | 421.94 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-N'-(3,5-dichloro-2-hydroxyphenyl)oxamide |
| SMILES | Cc1c(Cl)cc(NC(=O)C(=O)Nc2cc(Cl)cc(Cl)c2O)c(O)c1Cl |
| InChI | InChI=1S/C15H10Cl4N2O4/c1-5-7(17)4-10(13(23)11(5)19)21-15(25)14(24)20-9-3-6(16)2-8(18)12(9)22/h2-4,22-23H,1H3,(H,20,24)(H,21,25) |
| InChIKey | UZNKTMHHFGCQDH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.07 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|