C17H16Cl4N4O4 — CID 58828937
1-(3,5-dichloro-2-hydroxy-4-methylphenyl)-3-[[(3,5-dichloro-2-hydroxy-4-methylphenyl)carbamoylamino]methyl]urea (PubChem CID 58828937) has the molecular formula C17H16Cl4N4O4 and a molecular weight of 482.15 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-hydroxy-4-methylphenyl)-3-[[(3,5-dichloro-2-hydroxy-4-methylphenyl)carbamoylamino]methyl]urea.
| Compound Name | 1-(3,5-dichloro-2-hydroxy-4-methylphenyl)-3-[[(3,5-dichloro-2-hydroxy-4-methylphenyl)carbamoylamino]methyl]urea |
|---|---|
| PubChem CID | 58828937 |
| Molecular Formula | C17H16Cl4N4O4 |
| Molecular Weight | 482.15 g/mol |
| Exact Mass | 479.99 |
| IUPAC Name | 1-(3,5-dichloro-2-hydroxy-4-methylphenyl)-3-[[(3,5-dichloro-2-hydroxy-4-methylphenyl)carbamoylamino]methyl]urea |
| SMILES | Cc1c(Cl)cc(NC(=O)NCNC(=O)Nc2cc(Cl)c(C)c(Cl)c2O)c(O)c1Cl |
| InChI | InChI=1S/C17H16Cl4N4O4/c1-6-8(18)3-10(14(26)12(6)20)24-16(28)22-5-23-17(29)25-11-4-9(19)7(2)13(21)15(11)27/h3-4,26-27H,5H2,1-2H3,(H2,22,24,28)(H2,23,25,29) |
| InChIKey | CDRWXWREEWBOCH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.15 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|