C10H11Cl2NO3 — CID 102371943
ethyl N-(3,5-dichloro-2-hydroxy-4-methylphenyl)carbamate (PubChem CID 102371943) has the molecular formula C10H11Cl2NO3 and a molecular weight of 264.11 g/mol. Its IUPAC name is ethyl N-(3,5-dichloro-2-hydroxy-4-methylphenyl)carbamate.
| Compound Name | ethyl N-(3,5-dichloro-2-hydroxy-4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 102371943 |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | ethyl N-(3,5-dichloro-2-hydroxy-4-methylphenyl)carbamate |
| SMILES | CCOC(=O)Nc1cc(Cl)c(C)c(Cl)c1O |
| InChI | InChI=1S/C10H11Cl2NO3/c1-3-16-10(15)13-7-4-6(11)5(2)8(12)9(7)14/h4,14H,3H2,1-2H3,(H,13,15) |
| InChIKey | VPRJOMIQMBWAJM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|