C22H27Cl2NO3 — CID 101298579
(3-octylphenyl) N-(3,5-dichloro-2-hydroxy-4-methylphenyl)carbamate (PubChem CID 101298579) has the molecular formula C22H27Cl2NO3 and a molecular weight of 424.37 g/mol. Its IUPAC name is (3-octylphenyl) N-(3,5-dichloro-2-hydroxy-4-methylphenyl)carbamate.
| Compound Name | (3-octylphenyl) N-(3,5-dichloro-2-hydroxy-4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 101298579 |
| Molecular Formula | C22H27Cl2NO3 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (3-octylphenyl) N-(3,5-dichloro-2-hydroxy-4-methylphenyl)carbamate |
| SMILES | CCCCCCCCc1cccc(OC(=O)Nc2cc(Cl)c(C)c(Cl)c2O)c1 |
| InChI | InChI=1S/C22H27Cl2NO3/c1-3-4-5-6-7-8-10-16-11-9-12-17(13-16)28-22(27)25-19-14-18(23)15(2)20(24)21(19)26/h9,11-14,26H,3-8,10H2,1-2H3,(H,25,27) |
| InChIKey | ALBOVEWIVVGZHC-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|