C24H31Cl2NO3 — CID 101298643
N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-3-(2-octylphenoxy)propanamide (PubChem CID 101298643) has the molecular formula C24H31Cl2NO3 and a molecular weight of 452.42 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-3-(2-octylphenoxy)propanamide.
| Compound Name | N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-3-(2-octylphenoxy)propanamide |
|---|---|
| PubChem CID | 101298643 |
| Molecular Formula | C24H31Cl2NO3 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-3-(2-octylphenoxy)propanamide |
| SMILES | CCCCCCCCc1ccccc1OCCC(=O)Nc1cc(Cl)c(C)c(Cl)c1O |
| InChI | InChI=1S/C24H31Cl2NO3/c1-3-4-5-6-7-8-11-18-12-9-10-13-21(18)30-15-14-22(28)27-20-16-19(25)17(2)23(26)24(20)29/h9-10,12-13,16,29H,3-8,11,14-15H2,1-2H3,(H,27,28) |
| InChIKey | QCWUKOVHAMMTPC-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|