C21H25Cl2NO3 — CID 101298635
N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-3-(3-pentylphenoxy)propanamide (PubChem CID 101298635) has the molecular formula C21H25Cl2NO3 and a molecular weight of 410.34 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-3-(3-pentylphenoxy)propanamide.
| Compound Name | N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-3-(3-pentylphenoxy)propanamide |
|---|---|
| PubChem CID | 101298635 |
| Molecular Formula | C21H25Cl2NO3 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-3-(3-pentylphenoxy)propanamide |
| SMILES | CCCCCc1cccc(OCCC(=O)Nc2cc(Cl)c(C)c(Cl)c2O)c1 |
| InChI | InChI=1S/C21H25Cl2NO3/c1-3-4-5-7-15-8-6-9-16(12-15)27-11-10-19(25)24-18-13-17(22)14(2)20(23)21(18)26/h6,8-9,12-13,26H,3-5,7,10-11H2,1-2H3,(H,24,25) |
| InChIKey | VIMDTBKLWXTFHT-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|