C25H33Cl2NO3 — CID 101298681
N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-2-(3-nonylphenoxy)propanamide (PubChem CID 101298681) has the molecular formula C25H33Cl2NO3 and a molecular weight of 466.45 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-2-(3-nonylphenoxy)propanamide.
| Compound Name | N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-2-(3-nonylphenoxy)propanamide |
|---|---|
| PubChem CID | 101298681 |
| Molecular Formula | C25H33Cl2NO3 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxy-4-methylphenyl)-2-(3-nonylphenoxy)propanamide |
| SMILES | CCCCCCCCCc1cccc(OC(C)C(=O)Nc2cc(Cl)c(C)c(Cl)c2O)c1 |
| InChI | InChI=1S/C25H33Cl2NO3/c1-4-5-6-7-8-9-10-12-19-13-11-14-20(15-19)31-18(3)25(30)28-22-16-21(26)17(2)23(27)24(22)29/h11,13-16,18,29H,4-10,12H2,1-3H3,(H,28,30) |
| InChIKey | NRMLAYHRBRFMBZ-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|