C14H11Cl3N2OS — CID 87654577
1-(4-chlorophenyl)-3-(3,5-dichloro-2-hydroxy-4-methylphenyl)thiourea (PubChem CID 87654577) has the molecular formula C14H11Cl3N2OS and a molecular weight of 361.68 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(3,5-dichloro-2-hydroxy-4-methylphenyl)thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-(3,5-dichloro-2-hydroxy-4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 87654577 |
| Molecular Formula | C14H11Cl3N2OS |
| Molecular Weight | 361.68 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3,5-dichloro-2-hydroxy-4-methylphenyl)thiourea |
| SMILES | Cc1c(Cl)cc(NC(=S)Nc2ccc(Cl)cc2)c(O)c1Cl |
| InChI | InChI=1S/C14H11Cl3N2OS/c1-7-10(16)6-11(13(20)12(7)17)19-14(21)18-9-4-2-8(15)3-5-9/h2-6,20H,1H3,(H2,18,19,21) |
| InChIKey | MAUGLRRXFQVBDI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|