C13H8Cl4N2OS — CID 87654899
1-(3,5-dichloro-2-hydroxyphenyl)-3-(3,5-dichlorophenyl)thiourea (PubChem CID 87654899) has the molecular formula C13H8Cl4N2OS and a molecular weight of 382.10 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-hydroxyphenyl)-3-(3,5-dichlorophenyl)thiourea.
| Compound Name | 1-(3,5-dichloro-2-hydroxyphenyl)-3-(3,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 87654899 |
| Molecular Formula | C13H8Cl4N2OS |
| Molecular Weight | 382.10 g/mol |
| Exact Mass | 379.91 |
| IUPAC Name | 1-(3,5-dichloro-2-hydroxyphenyl)-3-(3,5-dichlorophenyl)thiourea |
| SMILES | Oc1c(Cl)cc(Cl)cc1NC(=S)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H8Cl4N2OS/c14-6-1-7(15)3-9(2-6)18-13(21)19-11-5-8(16)4-10(17)12(11)20/h1-5,20H,(H2,18,19,21) |
| InChIKey | ABFPBZQYAUWYPT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.10 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|