C26H18Cl5N5S2 — CID 10122211
1-[2-(4-chloroanilino)-5-[(3,5-dichlorophenyl)carbamothioylamino]phenyl]-3-(3,5-dichlorophenyl)thiourea (PubChem CID 10122211) has the molecular formula C26H18Cl5N5S2 and a molecular weight of 641.86 g/mol. Its IUPAC name is 1-[2-(4-chloroanilino)-5-[(3,5-dichlorophenyl)carbamothioylamino]phenyl]-3-(3,5-dichlorophenyl)thiourea.
| Compound Name | 1-[2-(4-chloroanilino)-5-[(3,5-dichlorophenyl)carbamothioylamino]phenyl]-3-(3,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 10122211 |
| Molecular Formula | C26H18Cl5N5S2 |
| Molecular Weight | 641.86 g/mol |
| Exact Mass | 638.94 |
| IUPAC Name | 1-[2-(4-chloroanilino)-5-[(3,5-dichlorophenyl)carbamothioylamino]phenyl]-3-(3,5-dichlorophenyl)thiourea |
| SMILES | S=C(Nc1cc(Cl)cc(Cl)c1)Nc1ccc(Nc2ccc(Cl)cc2)c(NC(=S)Nc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C26H18Cl5N5S2/c27-14-1-3-19(4-2-14)32-23-6-5-20(33-25(37)34-21-9-15(28)7-16(29)10-21)13-24(23)36-26(38)35-22-11-17(30)8-18(31)12-22/h1-13,32H,(H2,33,34,37)(H2,35,36,38) |
| InChIKey | MFPUAYFZDBBLFM-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.86 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|